phenyl 2-carbamoyloxy-5-methylbenzoate structure
|
Common Name | phenyl 2-carbamoyloxy-5-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 122277-24-1 | Molecular Weight | 271.26800 | |
| Density | 1.268g/cm3 | Boiling Point | 492.8ºC at 760mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | phenyl 2-carbamoyloxy-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 492.8ºC at 760mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 251.5ºC |
| Exact Mass | 271.08400 |
| PSA | 79.61000 |
| LogP | 3.18550 |
| Vapour Pressure | 7.41E-10mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | UTPCTWMCEYVCFX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(N)=O)c(C(=O)Oc2ccccc2)c1 |
|
~%
phenyl 2-carbam... CAS#:122277-24-1 |
| Literature: Kamal; Rao; Diwan; Sattur European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 487 - 489 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenyl 2-((aminocarbonyl)oxy)-5-methylbenzoate |
| Benzoic acid,2-((aminocarbonyl)oxy)-5-methyl-,phenyl ester |