3',4'-dimethyl-biphenyl-4-carboxylic acid structure
|
Common Name | 3',4'-dimethyl-biphenyl-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 122294-09-1 | Molecular Weight | 226.27000 | |
| Density | 1.132 g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 4-(3,4-dimethylphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.132 g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 180.6ºC |
| Exact Mass | 226.09900 |
| PSA | 37.30000 |
| LogP | 3.66860 |
| Vapour Pressure | 8.76E-07mmHg at 25°C |
| InChIKey | GFGYCDJAIZGZTK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)cc2)cc1C |
| HS Code | 2916399090 |
|---|
|
~77%
3',4'-dimethyl-... CAS#:122294-09-1 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2007/34277 A1, 2007 ; Location in patent: Page/Page column 54-55 ; |
|
~49%
3',4'-dimethyl-... CAS#:122294-09-1 |
| Literature: Tilley; Clader; Zawoiski; Wirkus; LeMahieu; O'Donnell; Crowley; Welton Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1814 - 1820 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD04117429 |
| 3',4'-Dimethyl-biphenyl-4-carboxylic acid |