Methane, bis(4-amino-3-methoxyphenyl)- structure
|
Common Name | Methane, bis(4-amino-3-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1223-20-7 | Molecular Weight | 258.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-amino-3-methoxyphenyl)methyl]-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18N2O2 |
|---|---|
| Molecular Weight | 258.31600 |
| Exact Mass | 258.13700 |
| PSA | 70.50000 |
| LogP | 3.62140 |
| InChIKey | LKHVCEWNPKEPBT-UHFFFAOYSA-N |
| SMILES | COc1cc(Cc2ccc(N)c(OC)c2)ccc1N |
| HS Code | 2922299090 |
|---|
|
~78%
Methane, bis(4-... CAS#:1223-20-7 |
| Literature: Barluenga, Jose; Bayon, Ana M.; Campos, Pedro; Asensio, Gregorio; Gonzalez-Nunez, Elena; Molina, Yolanda Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1631 - 1636 |
|
~%
Methane, bis(4-... CAS#:1223-20-7 |
| Literature: Finger Journal fuer Praktische Chemie (Leipzig), 1909 , vol. <2>79, p. 493 |
|
~%
Methane, bis(4-... CAS#:1223-20-7 |
| Literature: Nayar, Mazhuvadyil R. Gopinathan; Francis, Joseph D. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 776 - 780 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4'-methylenebis(2-methoxy-benzenamine) |
| 4.4'-Diamino-3.3'-dimethoxy-diphenylmethan |
| Benzenamine,4,4'-methylenebis[2-methoxy |
| 4,4'-Methylenedi-o-anisidine |
| Methane,bis(4-amino-3-methoxyphenyl) |
| Bis-(4-amino-3-methoxy-phenyl)-methan |
| 4-(4-amino-3-methoxybenzyl)-2-methoxyaniline |
| bis-(4-amino-3-methoxy-phenyl)-methane |