Ethyl 2-Acetamido-2-deoxy-β-D-thioglucopyranoside structure
|
Common Name | Ethyl 2-Acetamido-2-deoxy-β-D-thioglucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 122331-70-8 | Molecular Weight | 265.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(2S,3R,4R,5S,6R)-2-ethylsulfanyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H19NO5S |
|---|---|
| Molecular Weight | 265.32700 |
| Exact Mass | 265.09800 |
| PSA | 127.81000 |
| InChIKey | GLDKHCZSFYJVMF-IGORNWKESA-N |
| SMILES | CCSC1OC(CO)C(O)C(O)C1NC(C)=O |
|
~99%
Ethyl 2-Acetami... CAS#:122331-70-8 |
| Literature: Vic; Hastings; Howarth; Crout Tetrahedron Asymmetry, 1996 , vol. 7, # 3 p. 709 - 720 |
|
~%
Ethyl 2-Acetami... CAS#:122331-70-8 |
| Literature: Tetrahedron Asymmetry, , vol. 7, # 3 p. 709 - 720 |
|
~%
Ethyl 2-Acetami... CAS#:122331-70-8 |
| Literature: Journal of the Chemical Society, , p. 2042,2046 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethyl 2-(Acetylamino)-2-deoxy-1-thio-|A-D-glucopyranoside |
| Ethyl 2-Acetamido-2-deoxy-|A-D-thioglucopyranoside |