5-(4-(((2-Methoxyphenyl)(phenylazo)methylene)amino)phenyl)-1,3,4-oxadi azole-2(3H)-thione structure
|
Common Name | 5-(4-(((2-Methoxyphenyl)(phenylazo)methylene)amino)phenyl)-1,3,4-oxadi azole-2(3H)-thione | ||
|---|---|---|---|---|
| CAS Number | 122352-04-9 | Molecular Weight | 415.46800 | |
| Density | 1.31g/cm3 | Boiling Point | 558.1ºC at 760mmHg | |
| Molecular Formula | C22H17N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.4ºC | |
| Name | 2-methoxy-N-phenylimino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 558.1ºC at 760mmHg |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.46800 |
| Flash Point | 291.4ºC |
| Exact Mass | 415.11000 |
| PSA | 124.03000 |
| LogP | 5.89610 |
| Vapour Pressure | 1.72E-12mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | VWEBHROMPAWNOI-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(N=Nc1ccccc1)=Nc1ccc(-c2n[nH]c(=S)o2)cc1 |
|
~45%
5-(4-(((2-Metho... CAS#:122352-04-9 |
| Literature: Kalsi, Reena; Pande, Kalpana; Barthwal, J. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 197 - 199 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3,4-Oxadiazole-2(3H)-thione,5-(4-(((2-methoxyphenyl)(phenylazo)methylene)amino)phenyl) |
| 5-(4-(((2-Methoxyphenyl)(phenylazo)methylene)amino)phenyl)-1,3,4-oxadiazole-2(3H)-thione |
| 1,3,4-Oxadiazole-2(3H)-thione,5-[4-[[(2-methoxyphenyl)(2-phenyldiazenyl)methylene]amino]phenyl] |