2-methoxy-N-(2-methylphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide structure
|
Common Name | 2-methoxy-N-(2-methylphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 122352-05-0 | Molecular Weight | 429.49400 | |
| Density | 1.29g/cm3 | Boiling Point | 576.5ºC at 760mmHg | |
| Molecular Formula | C23H19N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5ºC | |
| Name | 2-methoxy-N-(2-methylphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 576.5ºC at 760mmHg |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.49400 |
| Flash Point | 302.5ºC |
| Exact Mass | 429.12600 |
| PSA | 124.03000 |
| LogP | 6.20450 |
| Vapour Pressure | 2.72E-13mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | FQHHQXSWQYGJLL-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(N=Nc1ccccc1C)=Nc1ccc(-c2n[nH]c(=S)o2)cc1 |
|
~35%
2-methoxy-N-(2-... CAS#:122352-05-0 |
| Literature: Kalsi, Reena; Pande, Kalpana; Barthwal, J. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 197 - 199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,4-Oxadiazole-2(3H)-thione,5-(4-(((2-methoxyphenyl)((2-methylphenyl)azo)methylene)amino)phenyl) |
| 5-(4-(((2-Methoxyphenyl)(2-methylphenylazo)methylene)amino)phenyl)-1,3,4-oxadiazole-2-thione |