2-methoxy-N-(4-methoxyphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide structure
|
Common Name | 2-methoxy-N-(4-methoxyphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 122352-06-1 | Molecular Weight | 445.49400 | |
| Density | 1.31g/cm3 | Boiling Point | 592.7ºC at 760 mmHg | |
| Molecular Formula | C23H19N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.2ºC | |
| Name | 2-methoxy-N-(4-methoxyphenyl)imino-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 592.7ºC at 760 mmHg |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.49400 |
| Flash Point | 312.2ºC |
| Exact Mass | 445.12100 |
| PSA | 133.26000 |
| LogP | 5.90470 |
| Vapour Pressure | 5.1E-14mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | QTGPQBDXKRKZIB-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=NC(=Nc2ccc(-c3n[nH]c(=S)o3)cc2)c2ccccc2OC)cc1 |
|
~48%
2-methoxy-N-(4-... CAS#:122352-06-1 |
| Literature: Kalsi, Reena; Pande, Kalpana; Barthwal, J. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 197 - 199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(4-((4-Methoxyphenylazo)((2-methoxyphenyl)methylene)amino)phenyl)-1,3,4-oxadiazole-2-thione |
| 1,3,4-Oxadiazole-2(3H)-thione,5-(4-(((4-methoxyphenyl)azo)((2-methoxyphenyl)methylene)amino)phenyl) |