N-(4-chlorophenyl)imino-2-methoxy-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide structure
|
Common Name | N-(4-chlorophenyl)imino-2-methoxy-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 122352-07-2 | Molecular Weight | 449.91300 | |
| Density | 1.37g/cm3 | Boiling Point | 584.7ºC at 760 mmHg | |
| Molecular Formula | C22H16ClN5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.4ºC | |
| Name | N-(4-chlorophenyl)imino-2-methoxy-N'-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 584.7ºC at 760 mmHg |
| Molecular Formula | C22H16ClN5O2S |
| Molecular Weight | 449.91300 |
| Flash Point | 307.4ºC |
| Exact Mass | 449.07100 |
| PSA | 124.03000 |
| LogP | 6.54950 |
| Vapour Pressure | 1.18E-13mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | NFNKEMFWOCOPMU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(N=Nc1ccc(Cl)cc1)=Nc1ccc(-c2n[nH]c(=S)o2)cc1 |
|
~70%
N-(4-chlorophen... CAS#:122352-07-2 |
| Literature: Kalsi, Reena; Pande, Kalpana; Barthwal, J. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 197 - 199 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3,4-Oxadiazole-2(3H)-thione,5-(4-((((4-chlorophenyl)azo)(2-methoxyphenyl)methylene)amino)phenyl) |
| 5-(4-((4-Chlorophenylazo)(2-methoxyphenyl)methyleneamino)phenyl)-1,3,4-oxadiazole-2(3H)-thione |