2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine
Modify Date: 2026-08-05 18:21:28
![2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine Structure](https://www.chemsrc.com/extcaspic/041/1223812-71-2.png)
2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine structure
|
Common Name | 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 1223812-71-2 | Molecular Weight | 363.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18FN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H18FN3S |
|---|---|
| Molecular Weight | 363.5 |
| InChIKey | GDKZFTWUFQXRKZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(-c2cc3c(SCc4ccc(F)cc4)nccn3n2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: Molecular formula of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is C21H18FN3S. |
| Q: What is the SMILES notation of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: SMILES notation of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is Cc1ccc(C)c(-c2cc3c(SCc4ccc(F)cc4)nccn3n2)c1. |
| Q: What is the Chinese name of 1223812-71-2? |
| A: Chinese name of 1223812-71-2 is 1223812-71-2. |
| Q: What is the molecular weight of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: Molecular weight of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is 363.5. |
| Q: What is the CAS number of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: CAS number of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is 1223812-71-2. |
| Q: What is the English name of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: The English name of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine. |
| Q: What is the InChIKey of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine? |
| A: InChIKey of 2-(2,5-Dimethylphenyl)-4-[(4-fluorobenzyl)thio]pyrazolo[1,5-a]pyrazine is GDKZFTWUFQXRKZ-UHFFFAOYSA-N. |