Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate
Modify Date: 2026-08-13 14:44:27
Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate structure
|
Common Name | Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate | ||
|---|---|---|---|---|
| CAS Number | 122388-02-7 | Molecular Weight | 649.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H33N3Na2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H33N3Na2O8S2 |
|---|---|
| Molecular Weight | 649.7 |
| InChIKey | BPEYPYBFBOPECT-UHFFFAOYSA-L |
| SMILES | CCCCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])cc(NC(C)=O)c3c2O)cc1.[Na+].[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: Molecular weight of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is 649.7. |
| Q: What is the SMILES notation of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: SMILES notation of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is CCCCCCCCCCc1ccc(N=Nc2c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])cc(NC(C)=O)c3c2O)cc1.[Na+].[Na+]. |
| Q: What is the Chinese name of 122388-02-7? |
| A: Chinese name of 122388-02-7 is 122388-02-7. |
| Q: What is the InChIKey of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: InChIKey of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is BPEYPYBFBOPECT-UHFFFAOYSA-L. |
| Q: What is the molecular formula of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: Molecular formula of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is C28H33N3Na2O8S2. |
| Q: What is the CAS number of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: CAS number of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is 122388-02-7. |
| Q: What is the English name of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate? |
| A: The English name of Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate is Disodium 5-acetamido-3-((4-decylphenyl)diazenyl)-4-hydroxynaphthalene-2,7-disulfonate. |