3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile structure
|
Common Name | 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile | ||
|---|---|---|---|---|
| CAS Number | 1224-39-1 | Molecular Weight | 272.38500 | |
| Density | 1.031g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.38500 |
| Flash Point | 206ºC |
| Exact Mass | 272.18900 |
| PSA | 36.26000 |
| LogP | 2.76418 |
| Vapour Pressure | 3.66E-07mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | PUJOAWZWLJQUCU-UHFFFAOYSA-N |
| SMILES | CC(C)C(C#N)(CCN1CCOCC1)c1ccccc1 |
|
~%
3-methyl-2-(2-m... CAS#:1224-39-1 |
| Literature: Casadio,S. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 589 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butyronitrile,2-isopropyl-4-morpholino-2-phenyl |
| 3-Methyl-2-(2-morpholinoethyl)-2-phenylbutyronitrile |
| 3-methyl-2-[2-(morpholin-4-yl)ethyl]-2-phenylbutanenitrile |
| Pentane,3-cyano-2-methyl-5-morpholino-3-phenyl |
| 3-methyl-2-(2-morpholin-4-yl-ethyl)-2-phenyl-butyronitrile |
| BUTYRONITRILE,3-METHYL-2-(2-MORPHOLINOETHYL)-2-PHENYL |