3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile
3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile structure
|
Common Name | 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile | ||
|---|---|---|---|---|
| CAS Number | 1224-39-1 | Molecular Weight | 272.38500 | |
| Density | 1.031g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.38500 |
| Flash Point | 206ºC |
| Exact Mass | 272.18900 |
| PSA | 36.26000 |
| LogP | 2.76418 |
| Vapour Pressure | 3.66E-07mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | PUJOAWZWLJQUCU-UHFFFAOYSA-N |
| SMILES | CC(C)C(C#N)(CCN1CCOCC1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-methyl-2-(2-m... CAS#:1224-39-1 |
| Literature: Casadio,S. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 589 - 593 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Butyronitrile,2-isopropyl-4-morpholino-2-phenyl |
| 3-Methyl-2-(2-morpholinoethyl)-2-phenylbutyronitrile |
| 3-methyl-2-[2-(morpholin-4-yl)ethyl]-2-phenylbutanenitrile |
| Pentane,3-cyano-2-methyl-5-morpholino-3-phenyl |
| 3-methyl-2-(2-morpholin-4-yl-ethyl)-2-phenyl-butyronitrile |
| BUTYRONITRILE,3-METHYL-2-(2-MORPHOLINOETHYL)-2-PHENYL |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: InChIKey of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is PUJOAWZWLJQUCU-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: Related upstream materials(CAS) of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile: 3240-94-6;5558-29-2. |
| Q: What is the LogP of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: LogP of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is 2.76418. |
| Q: What is the polar surface area (PSA) of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: Polar surface area (PSA) of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is 36.26000. |
| Q: What is the CAS number of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: CAS number of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is 1224-39-1. |
| Q: What is the Chinese name of 1224-39-1? |
| A: Chinese name of 1224-39-1 is 1224-39-1. |
| Q: What is the English name of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: The English name of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile. |
| Q: What is the molecular formula of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: Molecular formula of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is C17H24N2O. |
| Q: What English synonyms does 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile have? |
| A: English synonyms of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile: Butyronitrile,2-isopropyl-4-morpholino-2-phenyl, 3-Methyl-2-(2-morpholinoethyl)-2-phenylbutyronitrile, 3-methyl-2-[2-(morpholin-4-yl)ethyl]-2-phenylbutanenitrile, Pentane,3-cyano-2-methyl-5-morpholino-3-phenyl, 3-methyl-2-(2-morpholin-4-yl-ethyl)-2-phenyl-butyronitrile, BUTYRONITRILE,3-METHYL-2-(2-MORPHOLINOETHYL)-2-PHENYL. |
| Q: What is the SMILES notation of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile? |
| A: SMILES notation of 3-methyl-2-(2-morpholin-4-ylethyl)-2-phenylbutanenitrile is CC(C)C(C#N)(CCN1CCOCC1)c1ccccc1. |