ethyl 2-(6-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-yl)acetate
Modify Date: 2025-09-10 15:33:29
ethyl 2-(6-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-yl)acetate structure
|
Common Name | ethyl 2-(6-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 1224104-16-8 | Molecular Weight | 252.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(6-fluoro-5-methoxy-2,3-dihydro-1H-inden-1-yl)acetate |
|---|
| Molecular Formula | C14H17FO3 |
|---|---|
| Molecular Weight | 252.28100 |
| Exact Mass | 252.11600 |
| PSA | 35.53000 |
| LogP | 2.81730 |
| InChIKey | VCRFPCJABVCPSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCc2cc(OC)c(F)cc21 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |