(6-chloro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone structure
|
Common Name | (6-chloro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122438-03-3 | Molecular Weight | 355.81500 | |
| Density | 1.318g/cm3 | Boiling Point | 521.2ºC at 760mmHg | |
| Molecular Formula | C20H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269ºC | |
| Name | (6-chloro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 521.2ºC at 760mmHg |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.81500 |
| Flash Point | 269ºC |
| Exact Mass | 355.09800 |
| PSA | 38.77000 |
| LogP | 3.59490 |
| Vapour Pressure | 5.8E-11mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | VKIQYQWRSVENSH-UHFFFAOYSA-N |
| SMILES | O=C(C1=Cc2cc(Cl)ccc2OC1N1CCOCC1)c1ccccc1 |
|
~55%
(6-chloro-2-mor... CAS#:122438-03-3 |
| Literature: Rene; El Cherif; Boschi; Reny-Palasse; Rips European Journal of Medicinal Chemistry, 1988 , vol. 23, # 6 p. 592 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,(6-chloro-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenyl |
| (6-Chloro-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenylmethanone |