(6-bromo-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone structure
|
Common Name | (6-bromo-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122438-04-4 | Molecular Weight | 400.26600 | |
| Density | 1.46g/cm3 | Boiling Point | 531.6ºC at 760mmHg | |
| Molecular Formula | C20H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.3ºC | |
| Name | (6-bromo-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 531.6ºC at 760mmHg |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.26600 |
| Flash Point | 275.3ºC |
| Exact Mass | 399.04700 |
| PSA | 38.77000 |
| LogP | 3.70400 |
| Vapour Pressure | 2.21E-11mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | SUPYCNZLBMTYKU-UHFFFAOYSA-N |
| SMILES | O=C(C1=Cc2cc(Br)ccc2OC1N1CCOCC1)c1ccccc1 |
|
~58%
(6-bromo-2-morp... CAS#:122438-04-4 |
| Literature: Rene; El Cherif; Boschi; Reny-Palasse; Rips European Journal of Medicinal Chemistry, 1988 , vol. 23, # 6 p. 592 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (6-Bromo-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenylmethanone |
| Methanone,(6-bromo-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenyl |