(6-fluoro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone structure
|
Common Name | (6-fluoro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122438-05-5 | Molecular Weight | 339.36000 | |
| Density | 1.295g/cm3 | Boiling Point | 493.9ºC at 760mmHg | |
| Molecular Formula | C20H18FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | (6-fluoro-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 493.9ºC at 760mmHg |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.36000 |
| Flash Point | 252.5ºC |
| Exact Mass | 339.12700 |
| PSA | 38.77000 |
| LogP | 3.08060 |
| Vapour Pressure | 6.78E-10mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | VLUPLLLYOOTZAR-UHFFFAOYSA-N |
| SMILES | O=C(C1=Cc2cc(F)ccc2OC1N1CCOCC1)c1ccccc1 |
|
~54%
(6-fluoro-2-mor... CAS#:122438-05-5 |
| Literature: Rene; El Cherif; Boschi; Reny-Palasse; Rips European Journal of Medicinal Chemistry, 1988 , vol. 23, # 6 p. 592 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,(6-fluoro-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenyl |
| (6-Fluoro-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenylmethanone |