Methyl 5,5,5-trifluoro-4-(o-tolylamino)pentanoate
Modify Date: 2025-09-25 17:54:33
Methyl 5,5,5-trifluoro-4-(o-tolylamino)pentanoate structure
|
Common Name | Methyl 5,5,5-trifluoro-4-(o-tolylamino)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 1224599-56-7 | Molecular Weight | 275.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5,5,5-trifluoro-4-(2-methylanilino)pentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16F3NO2 |
|---|---|
| Molecular Weight | 275.26700 |
| Exact Mass | 275.11300 |
| PSA | 38.33000 |
| LogP | 3.36400 |
| InChIKey | XITXEXMJYBGARD-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(Nc1ccccc1C)C(F)(F)F |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Methyl 5,5,5-trifluoro-4-(o-tolylamino)pentanoate |
| methyl 4-(o-toluidino)-5,5,5-trifluoropentanoate |