2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane structure
|
Common Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane | ||
|---|---|---|---|---|
| CAS Number | 122502-53-8 | Molecular Weight | 224.10100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6F6O2 |
|---|---|
| Molecular Weight | 224.10100 |
| Exact Mass | 224.02700 |
| PSA | 21.76000 |
| LogP | 1.89500 |
| InChIKey | JMOAWAFFKGTPJU-UHFFFAOYSA-N |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC1CO1 |
| HS Code | 2910900090 |
|---|
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-[(1,1,2,3,3,3-Hexafluoropropoxy)methyl]oxirane |