4-[bis(2-chloroethyl)amino]-N,N-dimethyl-benzamide structure
|
Common Name | 4-[bis(2-chloroethyl)amino]-N,N-dimethyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 122567-50-4 | Molecular Weight | 289.20100 | |
| Density | 1.212g/cm3 | Boiling Point | 445.8ºC at 760 mmHg | |
| Molecular Formula | C13H18Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 4-[bis(2-chloroethyl)amino]-N,N-dimethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760 mmHg |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.20100 |
| Flash Point | 223.4ºC |
| Exact Mass | 288.08000 |
| PSA | 23.55000 |
| LogP | 2.67240 |
| Vapour Pressure | 3.82E-08mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | CMWKUHNLNXOMSD-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(N(CCCl)CCCl)cc1 |
|
~%
4-[bis(2-chloro... CAS#:122567-50-4 |
| Literature: Palmer, Brian D.; Wilson, William R.; Pullen, Susan M.; Denny, William A. Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 112 - 121 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzamide,4-(bis(2-chloroethyl)amino)-N,N-dimethyl |
| 4-(Bis(2-chloroethyl)amino)-N,N-dimethylbenzamide |