[(1R,3S)-3-(5,7-diaminotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol structure
|
Common Name | [(1R,3S)-3-(5,7-diaminotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 122624-71-9 | Molecular Weight | 249.27200 | |
| Density | 1.93g/cm3 | Boiling Point | 633.8ºC at 760mmHg | |
| Molecular Formula | C10H15N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.1ºC | |
| Name | [(1R,3S)-3-(5,7-diaminotriazolo[4,5-d]pyrimidin-3-yl)cyclopentyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.93g/cm3 |
|---|---|
| Boiling Point | 633.8ºC at 760mmHg |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.27200 |
| Flash Point | 337.1ºC |
| Exact Mass | 249.13400 |
| PSA | 129.49000 |
| LogP | 0.23050 |
| Vapour Pressure | 6.17E-17mmHg at 25°C |
| Index of Refraction | 1.943 |
| InChIKey | XVVDNPNNTOBKDF-RITPCOANSA-N |
| SMILES | Nc1nc(N)c2nnn(C3CCC(CO)C3)c2n1 |
|
~88%
[(1R,3S)-3-(5,7... CAS#:122624-71-9 |
| Literature: Vince; Hua Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 17 - 21 |
|
~%
[(1R,3S)-3-(5,7... CAS#:122624-71-9 |
| Literature: Vince; Hua Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 17 - 21 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+/-)-cis-[3-(5,7-Diamino-3H-1,2,3-triazolo[4,5-d]pyrimidin-3-yl)cyclopentenyl]carbinol |
| (+/-)-cis-<3-(5,7-diamino-3H-1,2,3-triazolo<4,5-d>pyrimidin-3-yl)cyclopentyl>carbinol |