H-D-Leu-Thr-Arg-pNA acetate salt structure
|
Common Name | H-D-Leu-Thr-Arg-pNA acetate salt | ||
|---|---|---|---|---|
| CAS Number | 122630-72-2 | Molecular Weight | 508.571 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H36N8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-D-Leu-Thr-Arg-pNA acetate saltD-Leu-Thr-Arg-pNA is a substrate for γ-Tryptase, and can be used to measure the effects of small molecule inhibitors on γ-Tryptase activity[1]. |
| Name | H-D-Leu-Thr-Arg-pNA |
|---|---|
| Synonym | More Synonyms |
| Description | D-Leu-Thr-Arg-pNA is a substrate for γ-Tryptase, and can be used to measure the effects of small molecule inhibitors on γ-Tryptase activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H36N8O6 |
| Molecular Weight | 508.571 |
| Exact Mass | 508.275787 |
| LogP | 1.01 |
| Index of Refraction | 1.631 |
| InChIKey | IBFUBQKPPLZOLE-ZSGPHXLJSA-N |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)O |
| H-D-LEU-THR-ARG-PNA |