N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide structure
|
Common Name | N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1226448-99-2 | Molecular Weight | 489.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24FN3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H24FN3O4S2 |
|---|---|
| Molecular Weight | 489.6 |
| InChIKey | MBYWUHSQFRWNNB-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccsc3C(=O)NCc3ccc(F)cc3)CC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: Molecular weight of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is 489.6. |
| Q: What is the Chinese name of 1226448-99-2? |
| A: Chinese name of 1226448-99-2 is 1226448-99-2. |
| Q: What is the English name of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: The English name of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide. |
| Q: What is the CAS number of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: CAS number of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is 1226448-99-2. |
| Q: What is the SMILES notation of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: SMILES notation of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is COc1ccc(N2CCN(S(=O)(=O)c3ccsc3C(=O)NCc3ccc(F)cc3)CC2)cc1. |
| Q: What is the molecular formula of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: Molecular formula of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is C23H24FN3O4S2. |
| Q: What is the InChIKey of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide? |
| A: InChIKey of N-(4-fluorobenzyl)-3-{[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl}thiophene-2-carboxamide is MBYWUHSQFRWNNB-UHFFFAOYSA-N. |