3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropanenitrile structure
|
Common Name | 3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 122648-74-2 | Molecular Weight | 274.27500 | |
| Density | 1.333g/cm3 | Boiling Point | 552.6ºC at 760mmHg | |
| Molecular Formula | C13H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288ºC | |
| Name | 3-[4-(4-nitrophenyl)piperazin-1-yl]-3-oxopropanenitrile |
|---|
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 552.6ºC at 760mmHg |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.27500 |
| Flash Point | 288ºC |
| Exact Mass | 274.10700 |
| PSA | 93.16000 |
| LogP | 1.68318 |
| Vapour Pressure | 2.95E-12mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | KUMCXTMKBWPBOF-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
3-[4-(4-nitroph... CAS#:122648-74-2 |
| Literature: Katz, H. E.; Schilling, M. L. Journal of the American Chemical Society, 1989 , vol. 111, # 19 p. 7554 - 7557 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |