ethyl 2-[3-(cyanomethyl)-4-oxophthalazin-1-yl]acetate structure
|
Common Name | ethyl 2-[3-(cyanomethyl)-4-oxophthalazin-1-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 122665-86-5 | Molecular Weight | 271.27100 | |
| Density | 1.27g/cm3 | Boiling Point | 463.3ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234ºC | |
| Name | ethyl 2-[3-(cyanomethyl)-4-oxophthalazin-1-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 463.3ºC at 760 mmHg |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.27100 |
| Flash Point | 234ºC |
| Exact Mass | 271.09600 |
| PSA | 84.98000 |
| LogP | 1.02568 |
| Vapour Pressure | 9.16E-09mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | VSAMVTQRKTVMHH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1nn(CC#N)c(=O)c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-cyanomethyl-4-oxo-phthalazin-1-ylacetate |
| Ethyl-3-cyanomethyl-4-oxo-3H-phthalazin-1-ylacetate |
| ethyl 3,4-dihydro-4-oxo-3-(3-cyanomethyl)-1-phthalazineacetate |
| ETHYL 2-[3-(CYANOMETHYL)-4-OXO-3,4-DIHYDROPHTHALAZIN-1-YL]ACETATE |