3,3'-Disulfanediyldibenzoic acid structure
|
Common Name | 3,3'-Disulfanediyldibenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1227-49-2 | Molecular Weight | 306.357 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 537.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H10O4S2 | Melting Point | 253-258ºC | |
| MSDS | N/A | Flash Point | 279.1±25.9 °C | |
| Name | 3,3'-Dithiobisbenzoic Acid, Technical Grade |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.9±35.0 °C at 760 mmHg |
| Melting Point | 253-258ºC |
| Molecular Formula | C14H10O4S2 |
| Molecular Weight | 306.357 |
| Flash Point | 279.1±25.9 °C |
| Exact Mass | 306.002045 |
| PSA | 125.20000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | GFUOAUHUTVPUIJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(SSc2cccc(C(=O)O)c2)c1 |
| HS Code | 2930909090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
| 3,3'-Disulfanediyldibenzoic acid |
| 3-[(3-carboxyphenyl)disulfanyl]benzoic acid |