3-(1-naphthyl)-d-alanine hydrochloride structure
|
Common Name | 3-(1-naphthyl)-d-alanine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 122745-09-9 | Molecular Weight | 251.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-α-Amino-1-naphthalenepropionic Acid Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14ClNO2 |
|---|---|
| Molecular Weight | 251.70900 |
| Exact Mass | 251.07100 |
| PSA | 63.32000 |
| LogP | 3.29650 |
| Index of Refraction | 8 ° (C=1, MeOH) |
| InChIKey | BKQQPCDQZZTLSE-UTONKHPSSA-N |
| SMILES | Cl.NC(Cc1cccc2ccccc12)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (R)-2-Amino-3-(naphthalen-1-yl)propanoic acid hydrochloride |
| 3-(1-Naphthyl)-D-alanine hydrochloride |
| (2R)-2-amino-3-naphthalen-1-ylpropanoic acid,hydrochloride |