4'-(Chloromethyl)-4,3':5',4''-terpyridine
Modify Date: 2026-07-23 17:41:37
4'-(Chloromethyl)-4,3':5',4''-terpyridine structure
|
Common Name | 4'-(Chloromethyl)-4,3':5',4''-terpyridine | ||
|---|---|---|---|---|
| CAS Number | 1227509-26-3 | Molecular Weight | 281.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-(Chloromethyl)-4,3':5',4''-terpyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12ClN3 |
|---|---|
| Molecular Weight | 281.74 |
| InChIKey | DJRPUGASCVXGSQ-UHFFFAOYSA-N |
| SMILES | ClCc1c(-c2ccncc2)cncc1-c1ccncc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: CAS number of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is 1227509-26-3. |
| Q: What is the SMILES notation of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: SMILES notation of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is ClCc1c(-c2ccncc2)cncc1-c1ccncc1. |
| Q: What is the molecular weight of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: Molecular weight of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is 281.74. |
| Q: What is the molecular formula of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: Molecular formula of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is C16H12ClN3. |
| Q: What is the InChIKey of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: InChIKey of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is DJRPUGASCVXGSQ-UHFFFAOYSA-N. |
| Q: What is the English name of 4'-(Chloromethyl)-4,3':5',4''-terpyridine? |
| A: The English name of 4'-(Chloromethyl)-4,3':5',4''-terpyridine is 4'-(Chloromethyl)-4,3':5',4''-terpyridine. |
| Q: What is the Chinese name of 1227509-26-3? |
| A: Chinese name of 1227509-26-3 is 1227509-26-3. |