4-(Bromomethyl)-5-chloro-2,4'-bipyridine structure
|
Common Name | 4-(Bromomethyl)-5-chloro-2,4'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 1227571-39-2 | Molecular Weight | 283.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Bromomethyl)-5-chloro-2,4'-bipyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8BrClN2 |
|---|---|
| Molecular Weight | 283.55 |
| InChIKey | VFPPKQIFIRBJFV-UHFFFAOYSA-N |
| SMILES | Clc1cnc(-c2ccncc2)cc1CBr |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: Molecular weight of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is 283.55. |
| Q: What is the CAS number of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: CAS number of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is 1227571-39-2. |
| Q: What is the InChIKey of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: InChIKey of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is VFPPKQIFIRBJFV-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: The English name of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is 4-(Bromomethyl)-5-chloro-2,4'-bipyridine. |
| Q: What is the SMILES notation of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: SMILES notation of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is Clc1cnc(-c2ccncc2)cc1CBr. |
| Q: What is the molecular formula of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine? |
| A: Molecular formula of 4-(Bromomethyl)-5-chloro-2,4'-bipyridine is C11H8BrClN2. |
| Q: What is the Chinese name of 1227571-39-2? |
| A: Chinese name of 1227571-39-2 is 1227571-39-2. |