(Racemic trans)-1-tert-butyl 3-methyl 4-(2-Chloro-5-methylpyridin-3-yl)pyrrolidine-1,3-dicarboxylate structure
|
Common Name | (Racemic trans)-1-tert-butyl 3-methyl 4-(2-Chloro-5-methylpyridin-3-yl)pyrrolidine-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1228070-72-1 | Molecular Weight | 354.82900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23ClN2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (Racemic trans)-1-tert-butyl 3-methyl 4-(2-Chloro-5-methylpyridin-3-yl)pyrrolidine-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H23ClN2O4 |
|---|---|
| Molecular Weight | 354.82900 |
| Exact Mass | 354.13500 |
| PSA | 68.73000 |
| LogP | 3.10480 |
| InChIKey | UHOACTCEPNBWQZ-OLZOCXBDSA-N |
| SMILES | COC(=O)C1CN(C(=O)OC(C)(C)C)CC1c1cc(C)cnc1Cl |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-O-tert-butyl 3-O-methyl (3R,4S)-4-(2-chloro-5-methylpyridin-3-yl)pyrrolidine-1,3-dicarboxylate |