4-chloro-2-fluoro-5-phenylmethoxyaniline structure
|
Common Name | 4-chloro-2-fluoro-5-phenylmethoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 122855-07-6 | Molecular Weight | 251.68400 | |
| Density | 1.306g/cm3 | Boiling Point | 389ºC at 760mmHg | |
| Molecular Formula | C13H11ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | 4-chloro-2-fluoro-5-phenylmethoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 389ºC at 760mmHg |
| Molecular Formula | C13H11ClFNO |
| Molecular Weight | 251.68400 |
| Flash Point | 189ºC |
| Exact Mass | 251.05100 |
| PSA | 35.25000 |
| LogP | 4.22150 |
| Vapour Pressure | 2.95E-06mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | UBCLWRBMYPPSFE-UHFFFAOYSA-N |
| SMILES | Nc1cc(OCc2ccccc2)c(Cl)cc1F |
|
~%
4-chloro-2-fluo... CAS#:122855-07-6 |
| Literature: Ando, Iwao; Ohtsuka, Toshikazu; Miki, Nobuo; Takahashi, Toshio; Hayase, Yoshio; Hayashi, Yoshiyuki Agricultural and Biological Chemistry, 1989 , vol. 53, # 7 p. 2001 - 2004 |
|
~%
4-chloro-2-fluo... CAS#:122855-07-6 |
| Literature: Ando, Iwao; Ohtsuka, Toshikazu; Miki, Nobuo; Takahashi, Toshio; Hayase, Yoshio; Hayashi, Yoshiyuki Agricultural and Biological Chemistry, 1989 , vol. 53, # 7 p. 2001 - 2004 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-benzyloxy-4-chloro-2-fluoroaniline |
| Aniline,4-chloro-2-fluoro-5-(phenylmethoxy) |
| 4-Chloro-2-fluoro-5-(phenylmethoxy)aniline |
| 4-chloro-2-fluoro-5-(phenylmethoxy)benzenamine |
| 5-benzyloxy-4-chloro-2-fluoro-phenylamine |