1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone
Modify Date: 2026-09-07 23:38:34
![1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone Structure](https://www.chemsrc.com/extcaspic/412/1228631-11-5.png)
1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone structure
|
Common Name | 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone | ||
|---|---|---|---|---|
| CAS Number | 1228631-11-5 | Molecular Weight | 285.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18F3NO |
|---|---|
| Molecular Weight | 285.30 |
| InChIKey | FHNKMTAPYYPXOM-UHFFFAOYSA-N |
| SMILES | O=C(CC1CCCN(Cc2ccccc2)C1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: The English name of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone. |
| Q: What is the SMILES notation of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: SMILES notation of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is O=C(CC1CCCN(Cc2ccccc2)C1)C(F)(F)F. |
| Q: What is the InChIKey of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: InChIKey of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is FHNKMTAPYYPXOM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: Molecular weight of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is 285.30. |
| Q: What is the molecular formula of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: Molecular formula of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is C15H18F3NO. |
| Q: What is the Chinese name of 1228631-11-5? |
| A: Chinese name of 1228631-11-5 is 1228631-11-5. |
| Q: What is the CAS number of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone? |
| A: CAS number of 1,1,1-Trifluoro-3-[1-(phenylmethyl)-3-piperidinyl]-2-propanone is 1228631-11-5. |