5-(benzenesulfonyl)-5-nitropentan-2-one structure
|
Common Name | 5-(benzenesulfonyl)-5-nitropentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 122876-03-3 | Molecular Weight | 271.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(benzenesulfonyl)-5-nitropentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO5S |
|---|---|
| Molecular Weight | 271.29000 |
| Exact Mass | 271.05100 |
| PSA | 105.41000 |
| LogP | 3.03630 |
| InChIKey | JWONQJHQXDAHFU-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC([N+](=O)[O-])S(=O)(=O)c1ccccc1 |
|
~37%
5-(benzenesulfo... CAS#:122876-03-3 |
| Literature: Park, Kwanghee Koh; Lee, Chul Woo; Choi, Sook Young Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1992 , # 5 p. 601 - 604 |
|
~%
5-(benzenesulfo... CAS#:122876-03-3 |
| Literature: Takeuchi, Yoshio; Nagata, Kazuhiro; Koizumi, Toru Journal of Organic Chemistry, 1989 , vol. 54, # 23 p. 5453 - 5459 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Pentanone,5-nitro-5-(phenylsulfonyl) |
| 5-nitro-5-(phenylsulfonyl)pentan-2-one |