2-[[4-chloro-5-(difluoromethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid structure
|
Common Name | 2-[[4-chloro-5-(difluoromethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 122881-57-6 | Molecular Weight | 363.71600 | |
| Density | 1.528g/cm3 | Boiling Point | 513.8ºC at 760mmHg | |
| Molecular Formula | C15H13ClF3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.5ºC | |
| Name | 2-[[4-chloro-5-(difluoromethoxy)-2-fluorophenyl]carbamoyl]cyclohexene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 513.8ºC at 760mmHg |
| Molecular Formula | C15H13ClF3NO4 |
| Molecular Weight | 363.71600 |
| Flash Point | 264.5ºC |
| Exact Mass | 363.04900 |
| PSA | 79.12000 |
| LogP | 4.62370 |
| Vapour Pressure | 2.22E-11mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | CTGABNJBHNAWDP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=C(C(=O)Nc2cc(OC(F)F)c(Cl)cc2F)CCCC1 |
|
~%
2-[[4-chloro-5-... CAS#:122881-57-6 |
| Literature: Ando, Iwao; Ohtsuka, Toshikazu; Miki, Nobuo; Takahashi, Toshio; Hayase, Yoshio; Hayashi, Yoshiyuki Agricultural and Biological Chemistry, 1989 , vol. 53, # 7 p. 2001 - 2004 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-Cyclohexene-1-carboxylicacid,2-[[[4-chloro-5-(difluoromethoxy)-2-fluorophenyl]amino]carbonyl] |