2-Methylamino-5-chlorophenylcyclohexylmethanone structure
|
Common Name | 2-Methylamino-5-chlorophenylcyclohexylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122908-18-3 | Molecular Weight | 251.75200 | |
| Density | 1.171 g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C14H18ClNO | Melting Point | 203.5ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methylamino-5-chlorophenylcyclohexylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171 g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Melting Point | 203.5ºC |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.75200 |
| Exact Mass | 251.10800 |
| PSA | 29.10000 |
| LogP | 4.21770 |
| Index of Refraction | 1.583 |
| InChIKey | SMTHIAYVTVYCMB-UHFFFAOYSA-N |
| SMILES | CNc1ccc(Cl)cc1C(=O)C1CCCCC1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-chloro-2-(methylaminophenyl)-cyclohexylmethanone |