AKOS B004653 structure
|
Common Name | AKOS B004653 | ||
|---|---|---|---|---|
| CAS Number | 123022-07-1 | Molecular Weight | 244.62800 | |
| Density | 1.42g/cm3 | Boiling Point | 418.2ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | 2-(2-chloro-4-formyl-6-methoxyphenoxy)acetic acid |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760 mmHg |
| Molecular Formula | C10H9ClO5 |
| Molecular Weight | 244.62800 |
| Flash Point | 206.7ºC |
| Exact Mass | 244.01400 |
| PSA | 72.83000 |
| LogP | 1.62450 |
| Vapour Pressure | 9.64E-08mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XJVLKGFEFMCVLZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(Cl)c1OCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |