(+)-Alschomine
Modify Date: 2026-09-27 12:29:34
(+)-Alschomine structure
|
Common Name | (+)-Alschomine | ||
|---|---|---|---|---|
| CAS Number | 123045-72-7 | Molecular Weight | 384.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (+)-Alschomine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24N2O5 |
|---|---|
| Molecular Weight | 384.4 |
| InChIKey | WHAYYXYTINYKPT-WGGBGCPLSA-N |
| SMILES | CC=C1C=[N+]([O-])C2CC1C(C(=O)OC)C13CC(OC)OC21Nc1ccccc13 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (+)-Alschomine? |
| A: The English name of (+)-Alschomine is (+)-Alschomine. |
| Q: What is the InChIKey of (+)-Alschomine? |
| A: InChIKey of (+)-Alschomine is WHAYYXYTINYKPT-WGGBGCPLSA-N. |
| Q: What is the molecular weight of (+)-Alschomine? |
| A: Molecular weight of (+)-Alschomine is 384.4. |
| Q: What is the CAS number of (+)-Alschomine? |
| A: CAS number of (+)-Alschomine is 123045-72-7. |
| Q: What is the Chinese name of 123045-72-7? |
| A: Chinese name of 123045-72-7 is 123045-72-7. |
| Q: What is the molecular formula of (+)-Alschomine? |
| A: Molecular formula of (+)-Alschomine is C21H24N2O5. |
| Q: What is the SMILES notation of (+)-Alschomine? |
| A: SMILES notation of (+)-Alschomine is CC=C1C=[N+]([O-])C2CC1C(C(=O)OC)C13CC(OC)OC21Nc1ccccc13. |