1-Phenanthrenecarboxylicacid, 1,2,3,4,4a,9,10,10a-octahydro-6-methoxy-1,4a-dimethyl-, methyl ester,(1S,4aS,10aR)- structure
|
Common Name | 1-Phenanthrenecarboxylicacid, 1,2,3,4,4a,9,10,10a-octahydro-6-methoxy-1,4a-dimethyl-, methyl ester,(1S,4aS,10aR)- | ||
|---|---|---|---|---|
| CAS Number | 1231-74-9 | Molecular Weight | 302.40800 | |
| Density | 1.068g/cm3 | Boiling Point | 390.8ºC at 760mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | 129-131ºC(lit.) | |
| MSDS | Chinese | Flash Point | 164.8ºC | |
| Name | Methyl 12-methoxy-8,11,13-prodocarpatrien-19-oate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760mmHg |
| Melting Point | 129-131ºC(lit.) |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 164.8ºC |
| Exact Mass | 302.18800 |
| PSA | 35.53000 |
| LogP | 3.87850 |
| Vapour Pressure | 2.57E-06mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | BSKWXDWRTACMCC-QRQLOZEOSA-N |
| SMILES | COC(=O)C1(C)CCCC2(C)c3cc(OC)ccc3CCC12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| methyl podocarpate O-methyl ether |
| 12-methoxy-podocarpa-8,11,13-trien-16-oic acid methyl ester |
| METHYL O-METHYLPODOCARPATE |
| 12-Methoxy-podocarpa-8,11,13-trien-16-saeure-methylester |
| 12-Methoxypodocarpa-8,11,13-triene-19-oic acid methyl ester |
| methyl 12-methoxypodocarpa-8,11,13-trien-19-oate |