(+)-Dehydroabietic acid structure
|
Common Name | (+)-Dehydroabietic acid | ||
|---|---|---|---|---|
| CAS Number | 1231-75-0 | Molecular Weight | 300.43500 | |
| Density | 1.058 g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C20H28O2 | Melting Point | 166-168ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of (+)-Dehydroabietic acid(+)-Dehydroabietic acid is a diterpenoid. (+)-Dehydroabietic acid can be used for the acrylamide Hydrogel synthesis[1]. |
| Name | (1R,4aS,10aS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Dehydroabietic acid is a diterpenoid. (+)-Dehydroabietic acid can be used for the acrylamide Hydrogel synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.058 g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Melting Point | 166-168ºC |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.43500 |
| Exact Mass | 300.20900 |
| PSA | 37.30000 |
| LogP | 4.90490 |
| InChIKey | NFWKVWVWBFBAOV-DFQSSKMNSA-N |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(C(=O)O)CCCC21C |
| HS Code | 2916399090 |
|---|
|
~%
(+)-Dehydroabie... CAS#:1231-75-0 |
| Literature: Angewandte Chemie - International Edition, , vol. 43, # 9 p. 1126 - 1129 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Dehydroabiet...saeure |
| abieta-8,11,13-trien-18-oic acid |
| Dehydro abietic acid |
| Dehydroabietinsaeure |