Tenofovir Monomethyl Ester structure
|
Common Name | Tenofovir Monomethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 123155-85-1 | Molecular Weight | 301.23900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N5O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Tenofovir Monomethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16N5O4P |
|---|---|
| Molecular Weight | 301.23900 |
| Exact Mass | 301.09400 |
| PSA | 135.19000 |
| LogP | 1.18410 |
| InChIKey | QNIIFMBLEIMHIO-SSDOTTSWSA-N |
| SMILES | COP(=O)(O)COC(C)Cn1cnc2c(N)ncnc21 |
|
~%
Tenofovir Monom... CAS#:123155-85-1 |
| Literature: Rosenberg, Ivan; Holy, Antonin; Masojidkova, Milena Collection of Czechoslovak Chemical Communications, 1988 , vol. 53, # 11B p. 2753 - 2777 |
|
~%
Tenofovir Monom... CAS#:123155-85-1 |
| Literature: Rosenberg, Ivan; Holy, Antonin; Masojidkova, Milena Collection of Czechoslovak Chemical Communications, 1988 , vol. 53, # 11B p. 2753 - 2777 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-methoxyphosphinic acid |