1-(Triisopropylsilyl)-1H-indole structure
|
Common Name | 1-(Triisopropylsilyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 123191-00-4 | Molecular Weight | 273.488 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 298.4±13.0 °C at 760 mmHg | |
| Molecular Formula | C17H27NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.3±19.8 °C | |
| Name | 1-(Triisopropylsilyl)indole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.4±13.0 °C at 760 mmHg |
| Molecular Formula | C17H27NSi |
| Molecular Weight | 273.488 |
| Flash Point | 134.3±19.8 °C |
| Exact Mass | 273.191284 |
| PSA | 4.93000 |
| LogP | 6.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | YQGQSALLXQDVFW-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~97%
1-(Triisopropyl... CAS#:123191-00-4 |
| Literature: Nippon Steel and Sumikin Chemical Co., Ltd.; SAWADA Yuichi; HOTTA Masanori; MATSUMOTO Megumi Patent: EP2628743 A1, 2013 ; Location in patent: Paragraph 0143 ; |
|
~3%
1-(Triisopropyl... CAS#:123191-00-4 |
| Literature: Heterocycles, , vol. 53, # 12 p. 2701 - 2708 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(Triisopropylsilyl)-1H-indole |
| indol-1-yl-tri(propan-2-yl)silane |