Heparin disaccharide IV-H structure
|
Common Name | Heparin disaccharide IV-H | ||
|---|---|---|---|---|
| CAS Number | 123228-39-7 | Molecular Weight | 337.28000 | |
| Density | 1.68g/cm3 | Boiling Point | 793.3ºC at 760 mmHg | |
| Molecular Formula | C12H19NO10 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 433.5ºC | |
| Name | 2-(5-amino-1,2,4-trihydroxy-6-oxohexan-3-yl)oxy-3,4-dihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 793.3ºC at 760 mmHg |
| Molecular Formula | C12H19NO10 |
| Molecular Weight | 337.28000 |
| Flash Point | 433.5ºC |
| Exact Mass | 337.10100 |
| PSA | 200.00000 |
| Vapour Pressure | 4.33E-29mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | RSCSYLOUHOXZCJ-UHFFFAOYSA-N |
| SMILES | NC(C=O)C(O)C(OC1OC(C(=O)O)=CC(O)C1O)C(O)CO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Heparin disaccharide IV-H |
| |A-| currencyUA-[1 inverted exclamation marku4]-GlcN |
| 4]-GlcN |