methyl 7-bromo-3-methoxynaphthalene-2-carboxylate structure
|
Common Name | methyl 7-bromo-3-methoxynaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 123266-51-3 | Molecular Weight | 295.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 7-bromo-3-methoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11BrO3 |
|---|---|
| Molecular Weight | 295.12900 |
| Exact Mass | 293.98900 |
| PSA | 35.53000 |
| LogP | 3.39750 |
| InChIKey | RDTGKUXAFSMVJE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(Br)ccc2cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Naphthalenecarboxylic acid,7-bromo-3-methoxy-,methyl ester |
| methyl 7-bromo-3-methoxy-2-naphthoate |