(3-oxocyclohexen-1-yl)methyl 2,2-dimethylpropanoate structure
|
Common Name | (3-oxocyclohexen-1-yl)methyl 2,2-dimethylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 123290-35-7 | Molecular Weight | 210.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-oxocyclohexen-1-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18O3 |
|---|---|
| Molecular Weight | 210.27000 |
| Exact Mass | 210.12600 |
| PSA | 43.37000 |
| LogP | 2.25510 |
| InChIKey | HVRKOUIKBJKVOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OCC1=CC(=O)CCC1 |
|
~%
(3-oxocyclohexe... CAS#:123290-35-7 |
| Literature: Knochel, Paul; Chou, Tso-Sheng; Jubert, Carole; Rajagopal, Duddu Journal of Organic Chemistry, 1993 , vol. 58, # 3 p. 588 - 599 |
|
~%
(3-oxocyclohexe... CAS#:123290-35-7 |
| Literature: Knochel, Paul; Chou, Tso-Sheng; Jubert, Carole; Rajagopal, Duddu Journal of Organic Chemistry, 1993 , vol. 58, # 3 p. 588 - 599 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Propanoic acid,2,2-dimethyl-,(3-oxo-1-cyclohexen-1-yl)methyl ester |
| (3-oxo-1-cyclohexen-1-yl)methyl pivalate |
| 2,2-dimethyl-propionic acid (3-oxo-1-cyclohexenyl)-methyl ester |