(2-butyl-4-methoxy-3-methylnaphthalen-1-yl) acetate structure
|
Common Name | (2-butyl-4-methoxy-3-methylnaphthalen-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 123332-24-1 | Molecular Weight | 286.36500 | |
| Density | 1.071g/cm3 | Boiling Point | 421ºC at 760mmHg | |
| Molecular Formula | C18H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | (2-butyl-4-methoxy-3-methylnaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760mmHg |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.36500 |
| Flash Point | 179ºC |
| Exact Mass | 286.15700 |
| PSA | 35.53000 |
| LogP | 4.42470 |
| Vapour Pressure | 2.7E-07mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | HEGRWEHIZSSHHW-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)c(OC)c2ccccc2c1OC(C)=O |
|
~%
(2-butyl-4-meth... CAS#:123332-24-1 |
| Literature: Yamashita; Schaub; Back; White; Toy; Ghazal; Burdick; Brashler; Holm Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 775 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-butyl-4-methoxy-3-methylnaphthalen-1-yl acetate |
| 1-Naphthalenol,2-butyl-4-methoxy-3-methyl-,acetate |