(2-butyl-4-methoxy-5,7,8-trimethylnaphthalen-1-yl) acetate structure
|
Common Name | (2-butyl-4-methoxy-5,7,8-trimethylnaphthalen-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 123332-30-9 | Molecular Weight | 314.41900 | |
| Density | 1.048g/cm3 | Boiling Point | 460.5ºC at 760mmHg | |
| Molecular Formula | C20H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | (2-butyl-4-methoxy-5,7,8-trimethylnaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760mmHg |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.41900 |
| Flash Point | 197.7ºC |
| Exact Mass | 314.18800 |
| PSA | 35.53000 |
| LogP | 5.04150 |
| Vapour Pressure | 1.16E-08mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | HLFSRZQHRJPAAC-UHFFFAOYSA-N |
| SMILES | CCCCc1cc(OC)c2c(C)cc(C)c(C)c2c1OC(C)=O |
|
~%
(2-butyl-4-meth... CAS#:123332-30-9 |
| Literature: Yamashita; Schaub; Back; White; Toy; Ghazal; Burdick; Brashler; Holm Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 775 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Naphthalenol,2-butyl-4-methoxy-5,7,8-trimethyl-,acetate |