(2,3-diethyl-4-methoxy-5,8-dimethylnaphthalen-1-yl) acetate structure
|
Common Name | (2,3-diethyl-4-methoxy-5,8-dimethylnaphthalen-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 123332-39-8 | Molecular Weight | 300.39200 | |
| Density | 1.06g/cm3 | Boiling Point | 411.3ºC at 760mmHg | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | (2,3-diethyl-4-methoxy-5,8-dimethylnaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 411.3ºC at 760mmHg |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.39200 |
| Flash Point | 174.5ºC |
| Exact Mass | 300.17300 |
| PSA | 35.53000 |
| LogP | 4.51530 |
| Vapour Pressure | 5.66E-07mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | AETDBZFZGCPXNU-UHFFFAOYSA-N |
| SMILES | CCc1c(CC)c(OC(C)=O)c2c(C)ccc(C)c2c1OC |
|
~%
(2,3-diethyl-4-... CAS#:123332-39-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 2 p. 775 - 781 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Naphthalenol,2,3-diethyl-4-methoxy-5,8-dimethyl-,acetate |
| 2,3-diethyl-4-methoxy-5,8-dimethylnaphthalen-1-yl acetate |