3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole
Modify Date: 2026-08-13 04:08:59
![3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole Structure](https://www.chemsrc.com/extcaspic/391/123345-76-6.png)
3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole structure
|
Common Name | 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole | ||
|---|---|---|---|---|
| CAS Number | 123345-76-6 | Molecular Weight | 232.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13ClN2 |
|---|---|
| Molecular Weight | 232.71 |
| InChIKey | JZQCNZOQBXKTDJ-UHFFFAOYSA-N |
| SMILES | ClCc1nn(-c2ccccc2)c2c1CCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: SMILES notation of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is ClCc1nn(-c2ccccc2)c2c1CCC2. |
| Q: What is the molecular weight of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: Molecular weight of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is 232.71. |
| Q: What is the Chinese name of 123345-76-6? |
| A: Chinese name of 123345-76-6 is 123345-76-6. |
| Q: What is the molecular formula of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: Molecular formula of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is C13H13ClN2. |
| Q: What is the English name of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: The English name of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole. |
| Q: What is the CAS number of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: CAS number of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is 123345-76-6. |
| Q: What is the InChIKey of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole? |
| A: InChIKey of 3-(chloromethyl)-1-phenyl-1H,4H,5H,6H-cyclopenta[c]pyrazole is JZQCNZOQBXKTDJ-UHFFFAOYSA-N. |