N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide
Modify Date: 2026-08-05 11:40:45
![N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide Structure](https://www.chemsrc.com/extcaspic/045/1234932-06-9.png)
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide structure
|
Common Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 1234932-06-9 | Molecular Weight | 309.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15N3O3 |
|---|---|
| Molecular Weight | 309.32 |
| InChIKey | KFQUGYYLZXFFPX-UHFFFAOYSA-N |
| SMILES | Cc1noc(CNC(=O)c2ccc(Oc3ccccc3)cc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: CAS number of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is 1234932-06-9. |
| Q: What is the molecular formula of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: Molecular formula of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is C17H15N3O3. |
| Q: What is the molecular weight of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: Molecular weight of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is 309.32. |
| Q: What is the SMILES notation of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: SMILES notation of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is Cc1noc(CNC(=O)c2ccc(Oc3ccccc3)cc2)n1. |
| Q: What is the Chinese name of 1234932-06-9? |
| A: Chinese name of 1234932-06-9 is 1234932-06-9. |
| Q: What is the English name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: The English name of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide. |
| Q: What is the InChIKey of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide? |
| A: InChIKey of N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-phenoxybenzamide is KFQUGYYLZXFFPX-UHFFFAOYSA-N. |