Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate
Modify Date: 2025-10-09 16:35:54
![Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/248/1234945-85-7.png)
Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate structure
|
Common Name | Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1234945-85-7 | Molecular Weight | 395.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21N3O3S |
|---|---|
| Molecular Weight | 395.5 |
| InChIKey | FWBAOTIKPFCCJM-UHFFFAOYSA-N |
| SMILES | O=C(NCC1CCN(C(=O)Oc2ccccc2)CC1)c1nc2ccccc2s1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: CAS number of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is 1234945-85-7. |
| Q: What is the molecular formula of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: Molecular formula of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is C21H21N3O3S. |
| Q: What is the SMILES notation of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: SMILES notation of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is O=C(NCC1CCN(C(=O)Oc2ccccc2)CC1)c1nc2ccccc2s1. |
| Q: What is the InChIKey of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: InChIKey of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is FWBAOTIKPFCCJM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: Molecular weight of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is 395.5. |
| Q: What is the Chinese name of 1234945-85-7? |
| A: Chinese name of 1234945-85-7 is 1234945-85-7. |
| Q: What is the English name of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate? |
| A: The English name of Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate is Phenyl 4-((benzo[d]thiazole-2-carboxamido)methyl)piperidine-1-carboxylate. |