3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-p-chloro-D-Phe-NH2, (Disulfide bond between Deamino-Cys1 and Cys6) structure
|
Common Name | 3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-p-chloro-D-Phe-NH2, (Disulfide bond between Deamino-Cys1 and Cys6) | ||
|---|---|---|---|---|
| CAS Number | 123528-93-8 | Molecular Weight | 964.591 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1368.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C46H58ClN9O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 781.3±34.3 °C | |
| Name | 3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-p-chloro-D-Phe-NH2 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1368.3±65.0 °C at 760 mmHg |
| Molecular Formula | C46H58ClN9O8S2 |
| Molecular Weight | 964.591 |
| Flash Point | 781.3±34.3 °C |
| Exact Mass | 963.353821 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | RCVDOCQSBXOOSH-UHFFFAOYSA-N |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccc(O)cc1)NC(=O)CCS)C(=O)NC(CS)C(=O)NC(Cc1ccc(Cl)cc1)C(N)=O |
| 1,2-Dithia-5,8,11,14,17-pentaazacycloeicosane-4-carboxamide, 10-(4-aminobutyl)-N-[(1R)-2-amino-1-[(4-chlorophenyl)methyl]-2-oxoethyl]-16-[(4-hydroxyphenyl)methyl]-13-(1H-indol-3-ylmethyl)-7-(1-methylethyl)-6,9,12,15,18-pentaoxo-, (4R,7S,10S,13R,16S)- |
| (4R,7S,10S,13R,16S)-10-(4-Aminobutyl)-N-[(2R)-1-amino-3-(4-chlorophenyl)-1-oxo-2-propanyl]-16-(4-hydroxybenzyl)-13-(1H-indol-3-ylmethyl)-7-isopropyl-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide |
| N-(3-Mercapto-1-oxopropyl)-L-tyrosyl-D-tryptophyl-L-lysyl-L-valyl-L-cysteinyl-4-chloro-D-phenylalaninamide cyclic (1→5)-disulfide |