N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide structure
|
Common Name | N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide | ||
|---|---|---|---|---|
| CAS Number | 1235633-74-5 | Molecular Weight | 287.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21N3O2 |
|---|---|
| Molecular Weight | 287.36 |
| InChIKey | OUIMNWOUYWQWMN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(CCNC(=O)COc2ccccc2C)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1235633-74-5? |
| A: Chinese name of 1235633-74-5 is 1235633-74-5. |
| Q: What is the SMILES notation of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: SMILES notation of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is Cc1cc(C)n(CCNC(=O)COc2ccccc2C)n1. |
| Q: What is the molecular formula of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: Molecular formula of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is C16H21N3O2. |
| Q: What is the CAS number of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: CAS number of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is 1235633-74-5. |
| Q: What is the molecular weight of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: Molecular weight of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is 287.36. |
| Q: What is the English name of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: The English name of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide. |
| Q: What is the InChIKey of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide? |
| A: InChIKey of N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl)-2-(o-tolyloxy)acetamide is OUIMNWOUYWQWMN-UHFFFAOYSA-N. |